D-Valine, 3-methyl-, 1,1-dimethylethyl ester structure
|
Common Name | D-Valine, 3-methyl-, 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 61169-85-5 | Molecular Weight | 187.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl (2S)-2-amino-3,3-dimethylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H21NO2 |
|---|---|
| Molecular Weight | 187.27900 |
| Exact Mass | 187.15700 |
| PSA | 52.32000 |
| LogP | 2.40180 |
| InChIKey | IGZORTGLYQDNMF-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)C(N)C(C)(C)C |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| tert-leucine tert-butyl ester |