[(2-methyl-1-phenylsulfanylpropyl)-phenylphosphoryl]benzene structure
|
Common Name | [(2-methyl-1-phenylsulfanylpropyl)-phenylphosphoryl]benzene | ||
|---|---|---|---|---|
| CAS Number | 61173-99-7 | Molecular Weight | 366.45600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23OPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2-methyl-1-phenylsulfanylpropyl)-phenylphosphoryl]benzene |
|---|
| Molecular Formula | C22H23OPS |
|---|---|
| Molecular Weight | 366.45600 |
| Exact Mass | 366.12100 |
| PSA | 52.18000 |
| LogP | 5.77490 |
| InChIKey | UUJKQWDYCHOPMU-UHFFFAOYSA-N |
| SMILES | CC(C)C(Sc1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
|
~%
[(2-methyl-1-ph... CAS#:61173-99-7 |
| Literature: Grayson,J.I.; Warren,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 2263 - 2272 |