1,3-dichloro-2-(2-nitrophenyl)sulfonylbenzene structure
|
Common Name | 1,3-dichloro-2-(2-nitrophenyl)sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61174-24-1 | Molecular Weight | 332.15900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7Cl2NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dichloro-2-(2-nitrophenyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7Cl2NO4S |
|---|---|
| Molecular Weight | 332.15900 |
| Exact Mass | 330.94700 |
| PSA | 88.34000 |
| LogP | 5.33840 |
| InChIKey | IBBGVDRFZQUWOB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)c1c(Cl)cccc1Cl |
|
~%
1,3-dichloro-2-... CAS#:61174-24-1 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |
| 2-Nitrophenyl-2,6-dichlorphenylsulfon |