2-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]propan-1-imine structure
|
Common Name | 2-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]propan-1-imine | ||
|---|---|---|---|---|
| CAS Number | 61185-82-8 | Molecular Weight | 294.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]propan-1-imine |
|---|
| Molecular Formula | C18H18N2S |
|---|---|
| Molecular Weight | 294.41400 |
| Exact Mass | 294.11900 |
| PSA | 53.49000 |
| LogP | 5.63000 |
| InChIKey | PQNCREJJXWWGEA-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccc(N=CC(C)C)cc3)sc2c1 |
|
~%
2-methyl-N-[4-(... CAS#:61185-82-8 |
| Literature: McCapra,F.; Burford,A. Journal of the Chemical Society, Chemical Communications, 1976 , p. 607 - 608 |