2,5-Bis(hydroxy(oxido)amino)-3-methyl-5,6,7,8-tetrahydro-4H-furo[3,2-c]azepin-4-one structure
|
Common Name | 2,5-Bis(hydroxy(oxido)amino)-3-methyl-5,6,7,8-tetrahydro-4H-furo[3,2-c]azepin-4-one | ||
|---|---|---|---|---|
| CAS Number | 61190-52-1 | Molecular Weight | 255.18400 | |
| Density | 1.57g/cm3 | Boiling Point | 449.7ºC at 760 mmHg | |
| Molecular Formula | C9H9N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | 3-methyl-2,5-dinitro-7,8-dihydro-6H-furo[3,2-c]azepin-4-one |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 449.7ºC at 760 mmHg |
| Molecular Formula | C9H9N3O6 |
| Molecular Weight | 255.18400 |
| Flash Point | 225.7ºC |
| Exact Mass | 255.04900 |
| PSA | 125.09000 |
| LogP | 2.06060 |
| Index of Refraction | 1.611 |
| InChIKey | CUCIVZYZUQCEFN-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])oc2c1C(=O)N([N+](=O)[O-])CCC2 |
|
~%
2,5-Bis(hydroxy... CAS#:61190-52-1 |
| Literature: Royer,R. et al. European Journal of Medicinal Chemistry, 1976 , vol. 11, p. 221 - 224 |
|
~%
2,5-Bis(hydroxy... CAS#:61190-52-1 |
| Literature: Royer,R. et al. European Journal of Medicinal Chemistry, 1976 , vol. 11, p. 221 - 224 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |