Carbanilide, N-methyl- structure
|
Common Name | Carbanilide, N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 612-01-1 | Molecular Weight | 226.27400 | |
| Density | 1.201g/cm3 | Boiling Point | 412.9ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | 1-methyl-1,3-diphenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760 mmHg |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.27400 |
| Flash Point | 203.5ºC |
| Exact Mass | 226.11100 |
| PSA | 32.34000 |
| LogP | 3.42790 |
| Index of Refraction | 1.662 |
| InChIKey | RLGZENVXTXVWJN-UHFFFAOYSA-N |
| SMILES | CN(C(=O)Nc1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Methyl-N,N'-diphenylurea |
| N-Methyl-N,N'-diphenylharnstoff |
| Carbanilide,N-methyl |
| N-methyl-Carbanilide |
| 3-Methyl-1,3-diphenylurea |
| Urea,N-methyl-N,N'-diphenyl |
| N,N'-diphenyl-N-methylurea |
| 1-methyl-1,3-diphenyl urea |