2,4,6-Tris(ethyldimethylsilyl)-2,3-hexadien-5-yne structure
|
Common Name | 2,4,6-Tris(ethyldimethylsilyl)-2,3-hexadien-5-yne | ||
|---|---|---|---|---|
| CAS Number | 61227-83-6 | Molecular Weight | 336.73500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H36Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-bis[ethyl(dimethyl)silyl]hexa-3,4-dien-1-yn-3-yl-ethyl-dimethylsilane |
|---|
| Molecular Formula | C18H36Si3 |
|---|---|
| Molecular Weight | 336.73500 |
| Exact Mass | 336.21200 |
| LogP | 6.26390 |
| InChIKey | AXOCYPGDOQXAKO-UHFFFAOYSA-N |
| SMILES | CC[Si](C)(C)C#CC(=C=C(C)[Si](C)(C)CC)[Si](C)(C)CC |
|
~%
2,4,6-Tris(ethy... CAS#:61227-83-6 |
| Literature: Priester,W.; West,R. Journal of the American Chemical Society, 1976 , vol. 98, p. 8426 - 8432 |