3-Methyl-1,3-bis(trimethylsilyl)-1-pentyne structure
|
Common Name | 3-Methyl-1,3-bis(trimethylsilyl)-1-pentyne | ||
|---|---|---|---|---|
| CAS Number | 61228-01-1 | Molecular Weight | 226.50600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H26Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(3-methyl-1-trimethylsilylpent-1-yn-3-yl)silane |
|---|
| Molecular Formula | C12H26Si2 |
|---|---|
| Molecular Weight | 226.50600 |
| Exact Mass | 226.15700 |
| LogP | 4.37570 |
| InChIKey | JIGMWKAYLNHHRS-UHFFFAOYSA-N |
| SMILES | CCC(C)(C#C[Si](C)(C)C)[Si](C)(C)C |
|
~%
3-Methyl-1,3-bi... CAS#:61228-01-1 |
| Literature: Priester,W.; West,R. Journal of the American Chemical Society, 1976 , vol. 98, p. 8421 - 8425 |