Triphenyl(3,4,5-trimethoxybenzyl)phosphonium bromide structure
|
Common Name | Triphenyl(3,4,5-trimethoxybenzyl)phosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 61240-20-8 | Molecular Weight | 523.39800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H28BrO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenyl-(3,4,5-trimethoxy-benzyl)-phosphonium, bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H28BrO3P |
|---|---|
| Molecular Weight | 523.39800 |
| Exact Mass | 522.09600 |
| PSA | 41.28000 |
| LogP | 2.21050 |
| InChIKey | DFQCYFWOOKHMQB-UHFFFAOYSA-M |
| SMILES | COc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1OC.[Br-] |
| Storage condition | 2-8°C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3,4,5-trimethoxybenzylphosphonium bromide |
| 3,4,5-trimethoxybenzyltriphenylphosphonium bromide |
| 3,4,5-trimethoxybenzyltriphenylphosphine bromide |