1H-Pyrazole-3-carbonitrile,4-nitro- structure
|
Common Name | 1H-Pyrazole-3-carbonitrile,4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 61241-07-4 | Molecular Weight | 138.08400 | |
| Density | 1.63g/cm3 | Boiling Point | 468.3ºC at 760mmHg | |
| Molecular Formula | C4H2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | 4-nitro-1H-pyrazole-5-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 468.3ºC at 760mmHg |
| Molecular Formula | C4H2N4O2 |
| Molecular Weight | 138.08400 |
| Flash Point | 237ºC |
| Exact Mass | 138.01800 |
| PSA | 98.29000 |
| LogP | 0.71278 |
| Index of Refraction | 1.602 |
| InChIKey | BLSWMOIYTDLKTA-UHFFFAOYSA-N |
| SMILES | N#Cc1[nH]ncc1[N+](=O)[O-] |
| HS Code | 2933199090 |
|---|
|
~10%
1H-Pyrazole-3-c... CAS#:61241-07-4 |
| Literature: Semeraro, Teresa; Mugnaini, Claudia; Manetti, Fabrizio; Pasquini, Serena; Corelli, Federico Tetrahedron, 2008 , vol. 64, # 49 p. 11249 - 11255 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitro-3-cyanopyrazol |
| 3-Cyano-4-nitro-pyrazol |
| 4-nitro-1H-pyrazole-3-carbonitrile |
| 4-nitropyrazole-3-carbonitrile |
| 4-nitro-1(2)H-pyrazole-3-carbonitrile |
| 3-cyano-4-nitropyrazole |
| 3-Cyan-4-nitro-pyrazol |