3-[2-cyanoethoxy-[diazo(phenyl)methyl]phosphoryl]oxypropanenitrile structure
|
Common Name | 3-[2-cyanoethoxy-[diazo(phenyl)methyl]phosphoryl]oxypropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 61244-81-3 | Molecular Weight | 304.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13N4O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[2-cyanoethoxy-[diazo(phenyl)methyl]phosphoryl]oxypropanenitrile |
|---|
| Molecular Formula | C13H13N4O3P |
|---|---|
| Molecular Weight | 304.24100 |
| Exact Mass | 304.07300 |
| PSA | 130.31000 |
| LogP | 2.79772 |
| InChIKey | RDWXKWBWWIKGDK-UHFFFAOYSA-N |
| SMILES | N#CCCOP(=O)(OCCC#N)C(=[N+]=[N-])c1ccccc1 |
|
~%
3-[2-cyanoethox... CAS#:61244-81-3 |
| Literature: Goldstein,J.A. et al. Journal of the American Chemical Society, 1976 , vol. 98, p. 7327 - 7332 |