2-(4-methylphenyl)sulfonylethyl 2-bromoacetate structure
|
Common Name | 2-(4-methylphenyl)sulfonylethyl 2-bromoacetate | ||
|---|---|---|---|---|
| CAS Number | 61254-69-1 | Molecular Weight | 321.18800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13BrO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methylphenyl)sulfonylethyl 2-bromoacetate |
|---|
| Molecular Formula | C11H13BrO4S |
|---|---|
| Molecular Weight | 321.18800 |
| Exact Mass | 319.97200 |
| PSA | 68.82000 |
| LogP | 2.78760 |
| InChIKey | SSBLGQDKGUUYSG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CCOC(=O)CBr)cc1 |
|
~%
2-(4-methylphen... CAS#:61254-69-1 |
| Literature: Colvin,E.W. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1718 - 1722 |