2,2,4,4-tetramethylpentan-3-ylsulfanylmethylbenzene structure
|
Common Name | 2,2,4,4-tetramethylpentan-3-ylsulfanylmethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61259-04-9 | Molecular Weight | 250.44300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4,4-tetramethylpentan-3-ylsulfanylmethylbenzene |
|---|
| Molecular Formula | C16H26S |
|---|---|
| Molecular Weight | 250.44300 |
| Exact Mass | 250.17600 |
| PSA | 25.30000 |
| LogP | 5.38060 |
| InChIKey | XJVZFEZWIDYNCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(SCc1ccccc1)C(C)(C)C |
|
~%
2,2,4,4-tetrame... CAS#:61259-04-9 |
| Literature: Buter,J.; Kellogg,R.M. Journal of Organic Chemistry, 1977 , vol. 42, # 6 p. 973 - 976 |
|
~%
2,2,4,4-tetrame... CAS#:61259-04-9 |
| Literature: Buter,J.; Kellogg,R.M. Journal of Organic Chemistry, 1977 , vol. 42, # 6 p. 973 - 976 |