1-(2-chloro-6-nitro-phenyl)propan-2-one structure
|
Common Name | 1-(2-chloro-6-nitro-phenyl)propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 6127-12-4 | Molecular Weight | 213.61800 | |
| Density | 1.337g/cm3 | Boiling Point | 301.7ºC at 760 mmHg | |
| Molecular Formula | C9H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.2ºC | |
| Name | 1-(2-chloro-6-nitrophenyl)propan-2-one |
|---|
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 301.7ºC at 760 mmHg |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.61800 |
| Flash Point | 136.2ºC |
| Exact Mass | 213.01900 |
| PSA | 62.89000 |
| LogP | 2.90290 |
| Index of Refraction | 1.563 |
| InChIKey | BEDTWFGUSVIAKD-UHFFFAOYSA-N |
| SMILES | CC(=O)Cc1c(Cl)cccc1[N+](=O)[O-] |
|
~%
1-(2-chloro-6-n... CAS#:6127-12-4 |
| Literature: Piper,J.R.; Stevens,F.J. Journal of Heterocyclic Chemistry, 1966 , vol. 3, p. 95 - 97 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |