2-(6-chloro-2-methyl-1H-indol-3-yl)acetic acid structure
|
Common Name | 2-(6-chloro-2-methyl-1H-indol-3-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6127-21-5 | Molecular Weight | 223.65600 | |
| Density | 1.419g/cm3 | Boiling Point | 448.4ºC at 760 mmHg | |
| Molecular Formula | C11H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225ºC | |
| Name | (6-chloro-2-methyl-indol-3-yl)-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.419g/cm3 |
|---|---|
| Boiling Point | 448.4ºC at 760 mmHg |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.65600 |
| Flash Point | 225ºC |
| Exact Mass | 223.04000 |
| PSA | 53.09000 |
| LogP | 2.75680 |
| Index of Refraction | 1.677 |
| InChIKey | CRCFIUIKYLJTBK-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c2cc(Cl)ccc2c1CC(=O)O |
|
~%
2-(6-chloro-2-m... CAS#:6127-21-5 |
| Literature: Piper; Stevens Journal of Organic Chemistry, 1962 , vol. 27, p. 3134,3136 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-Chlor-2-methyl-indol-3-essigsaeure |