1-[2-hydroxy-4-(5-phenoxypentylsulfanyl)phenyl]ethanone structure
|
Common Name | 1-[2-hydroxy-4-(5-phenoxypentylsulfanyl)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 61270-16-4 | Molecular Weight | 330.44100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-hydroxy-4-(5-phenoxypentylsulfanyl)phenyl]ethanone |
|---|
| Molecular Formula | C19H22O3S |
|---|---|
| Molecular Weight | 330.44100 |
| Exact Mass | 330.12900 |
| PSA | 71.83000 |
| LogP | 4.93620 |
| InChIKey | FVVGVIHGVKZRHT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(SCCCCCOc2ccccc2)cc1O |
|
~%
1-[2-hydroxy-4-... CAS#:61270-16-4 |
| Literature: Appleton,R.A. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 371 - 379 |
|
~%
1-[2-hydroxy-4-... CAS#:61270-16-4 |
| Literature: Appleton,R.A. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 371 - 379 |