1-t-butyl-5-methyl-4-phenylimidazole structure
|
Common Name | 1-t-butyl-5-methyl-4-phenylimidazole | ||
|---|---|---|---|---|
| CAS Number | 61278-76-0 | Molecular Weight | 214.306 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 358.9±11.0 °C at 760 mmHg | |
| Molecular Formula | C14H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.8±19.3 °C | |
| Name | 1-tert-butyl-5-methyl-4-phenylimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 358.9±11.0 °C at 760 mmHg |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.306 |
| Flash Point | 170.8±19.3 °C |
| Exact Mass | 214.147003 |
| PSA | 17.82000 |
| LogP | 4.18 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | YOCMPFXUDVLXAR-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccccc2)ncn1C(C)(C)C |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Imidazole, 1-(1,1-dimethylethyl)-5-methyl-4-phenyl- |
| 1-tert-Butyl-5-methyl-4-phenyl-1H-imidazole |
| 1-tert-Butyl-5-methyl-4-phenylimidazol |
| 5-Methyl-1-(2-methyl-2-propanyl)-4-phenyl-1H-imidazole |
| 1-t-butyl-5-methyl-4-phenylimidazole |