4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide structure
|
Common Name | 4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 61292-08-8 | Molecular Weight | 233.29000 | |
| Density | 1.287g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H11N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.29000 |
| Exact Mass | 233.06200 |
| PSA | 96.25000 |
| LogP | 2.81320 |
| Index of Refraction | 1.632 |
| InChIKey | GQSOVDYCSQOIJB-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NN |
| HS Code | 2934100090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-methyl-2-phenyl-thiazole-5-carboxylic acid hydrazide |
| 2-Phenyl-4-methyl-5-thiazolylcarboxyl-hydrazid |
| 4-methyl-2-phenylthiazol-5-carbohydrazide |
| 2-Phenyl-4-methylthiazolcarbonsaeurehydrazid-(5) |