amphi-naphthoquinone
amphi-naphthoquinone structure
|
Common Name | amphi-naphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 613-20-7 | Molecular Weight | 158.15300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-naphthoquinone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H6O2 |
|---|---|
| Molecular Weight | 158.15300 |
| Exact Mass | 158.03700 |
| PSA | 34.14000 |
| LogP | 1.11700 |
| InChIKey | SLBHRPOLVUEFSG-UHFFFAOYSA-N |
| SMILES | O=C1C=CC2=CC(=O)C=CC2=C1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:581-43-1
CAS#:1059-86-5
CAS#:5486-55-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2.6-Dioxo-2.6-dihydro-naphthalin |
| Bicyclo-[0.4.4]-decatetren-(1(2).4.6(7).9)-dion-(3.8) |
| naphthalene-2,6-dione |
| Naphthalin-2,6-dion |
| 2.6-Dioxo-naphthalin-dihydrid-(2.6) |
| β1.β3-Diketo-dihydronaphthalin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2,6-naphthoquinone have? |
| A: English synonyms of 2,6-naphthoquinone: 2.6-Dioxo-2.6-dihydro-naphthalin, Bicyclo-[0.4.4]-decatetren-(1(2).4.6(7).9)-dion-(3.8), naphthalene-2,6-dione, Naphthalin-2,6-dion, 2.6-Dioxo-naphthalin-dihydrid-(2.6), β1.β3-Diketo-dihydronaphthalin. |
| Q: What is the SMILES notation of 2,6-naphthoquinone? |
| A: SMILES notation of 2,6-naphthoquinone is O=C1C=CC2=CC(=O)C=CC2=C1. |
| Q: What is the LogP of 2,6-naphthoquinone? |
| A: LogP of 2,6-naphthoquinone is 1.11700. |
| Q: What are the downstream products of 2,6-naphthoquinone? |
| A: Related downstream products(CAS) of 2,6-naphthoquinone: 581-43-1;1059-86-5;5486-55-5. |
| Q: What is the InChIKey of 2,6-naphthoquinone? |
| A: InChIKey of 2,6-naphthoquinone is SLBHRPOLVUEFSG-UHFFFAOYSA-N. |
| Q: What is the English name of 2,6-naphthoquinone? |
| A: The English name of 2,6-naphthoquinone is 2,6-naphthoquinone. |
| Q: What is the Chinese name of 613-20-7? |
| A: Chinese name of 613-20-7 is 613-20-7. |
| Q: What is the molecular weight of 2,6-naphthoquinone? |
| A: Molecular weight of 2,6-naphthoquinone is 158.15300. |
| Q: What is the polar surface area (PSA) of 2,6-naphthoquinone? |
| A: Polar surface area (PSA) of 2,6-naphthoquinone is 34.14000. |
| Q: What is the CAS number of 2,6-naphthoquinone? |
| A: CAS number of 2,6-naphthoquinone is 613-20-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |