(3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid
Modify Date: 2026-08-29 12:16:10
(3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid structure
|
Common Name | (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 613-41-2 | Molecular Weight | 242.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10O4 |
|---|---|
| Molecular Weight | 242.23 |
| InChIKey | LVEQUEJWJRJCST-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)C=Cc1cc2ccccc2cc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid? |
| A: The English name of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid is (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid. |
| Q: What is the molecular weight of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid? |
| A: Molecular weight of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid is 242.23. |
| Q: What is the molecular formula of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid? |
| A: Molecular formula of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid is C14H10O4. |
| Q: What is the CAS number of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid? |
| A: CAS number of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid is 613-41-2. |
| Q: What is the SMILES notation of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid? |
| A: SMILES notation of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid is O=C(O)C(=O)C=Cc1cc2ccccc2cc1O. |
| Q: What is the InChIKey of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid? |
| A: InChIKey of (3E)-4-(3-Hydroxynaphthalen-2-YL)-2-oxobut-3-enoic acid is LVEQUEJWJRJCST-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 613-41-2? |
| A: Chinese name of 613-41-2 is 613-41-2. |