1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one
![1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one Structure](https://image.chemsrc.com/caspic/198/61314-29-2.png)
1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one structure
|
Common Name | 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61314-29-2 | Molecular Weight | 474.76000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H50O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C34H50O |
|---|---|
| Molecular Weight | 474.76000 |
| Exact Mass | 474.38600 |
| PSA | 17.07000 |
| LogP | 10.22220 |
| InChIKey | KOZPTKWIUOTORQ-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)c1ccc2c(c1)Cc1cc(CCCCC(CCC(C)C)CCC(C)C)ccc1-2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-[7-[8-methyl-... CAS#:61314-29-2 |
| Literature: Malthete, Jacques; Canceill, Josette; Gabard, Jacqueline; Jacques, Jean Tetrahedron, 1981 , vol. 37, # 16 p. 2823 - 2828 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one? |
| A: LogP of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one is 10.22220. |
| Q: What is the Chinese name of 61314-29-2? |
| A: Chinese name of 61314-29-2 is 61314-29-2. |
| Q: What is the molecular formula of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one? |
| A: Molecular formula of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one is C34H50O. |
| Q: What is the CAS number of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one? |
| A: CAS number of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one is 61314-29-2. |
| Q: What is the English name of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one? |
| A: The English name of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one is 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one. |
| Q: What is the molecular weight of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one? |
| A: Molecular weight of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one is 474.76000. |
| Q: What is the polar surface area (PSA) of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one? |
| A: Polar surface area (PSA) of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one is 17.07000. |
| Q: What is the InChIKey of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one? |
| A: InChIKey of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one is KOZPTKWIUOTORQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one? |
| A: SMILES notation of 1-[7-[8-methyl-5-(3-methylbutyl)nonyl]-9H-fluoren-2-yl]hexan-1-one is CCCCCC(=O)c1ccc2c(c1)Cc1cc(CCCCC(CCC(C)C)CCC(C)C)ccc1-2. |