boc-d-methionine dicyclohexylamine salt structure
|
Common Name | boc-d-methionine dicyclohexylamine salt | ||
|---|---|---|---|---|
| CAS Number | 61315-59-1 | Molecular Weight | 430.64500 | |
| Density | N/A | Boiling Point | 415.5ºC at 760 mmHg | |
| Molecular Formula | C22H42N2O4S | Melting Point | 141-143ºC(lit.) | |
| MSDS | USA | Flash Point | 205.1ºC | |
Use of boc-d-methionine dicyclohexylamine saltBoc-D-Met-OH (dicyclohexylammonium) salt is a Methionine (HY-13694) derivative[1]. |
| Name | N-cyclohexylcyclohexanamine,(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-D-Met-OH (dicyclohexylammonium) salt is a Methionine (HY-13694) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 415.5ºC at 760 mmHg |
|---|---|
| Melting Point | 141-143ºC(lit.) |
| Molecular Formula | C22H42N2O4S |
| Molecular Weight | 430.64500 |
| Flash Point | 205.1ºC |
| Exact Mass | 430.28700 |
| PSA | 116.45000 |
| LogP | 5.55410 |
| InChIKey | SKDIPRMGDVUUQO-HMZWWLAASA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CSCCC(NC(=O)OC(C)(C)C)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| MFCD00038890 |
| EINECS 262-707-2 |
| (2R)-2-[(tert-butoxy)carbonylamino]-4-methylthiobutanoic acid,dicyclohexylami ne |
| Boc-D-methionine (dicyclohexylammonium) salt |
| Boc-D-Met-OH (dicyclohexylammonium) salt |