2,4(1H,3H)-Pyrimidinedione,6-amino-1,3-dimethyl-5-(1-oxo-3-phenylpropyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-amino-1,3-dimethyl-5-(1-oxo-3-phenylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 61317-77-9 | Molecular Weight | 287.31400 | |
| Density | 1.266g/cm3 | Boiling Point | 436.3ºC at 760 mmHg | |
| Molecular Formula | C15H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.7ºC | |
| Name | 6-amino-1,3-dimethyl-5-(3-phenylpropanoyl)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760 mmHg |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.31400 |
| Flash Point | 217.7ºC |
| Exact Mass | 287.12700 |
| PSA | 87.09000 |
| LogP | 1.06290 |
| Index of Refraction | 1.591 |
| InChIKey | SDWBSCCBHASHEV-UHFFFAOYSA-N |
| SMILES | Cn1c(N)c(C(=O)CCc2ccccc2)c(=O)n(C)c1=O |
|
~77%
2,4(1H,3H)-Pyri... CAS#:61317-77-9 |
| Literature: Bernier; Henichart; Warin; Trentesaux; Jardillier Journal of Medicinal Chemistry, 1985 , vol. 28, # 4 p. 497 - 502 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-amino-1,3-dimethyl-5-(3-phenyl-propionyl)-1H-pyrimidine-2,4-dione |
| 1,3-dimethyl-5-<(2-phenylethyl)carbonyl>-6-aminouracil |