2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine
![2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine Structure](https://image.chemsrc.com/caspic/457/61326-00-9.png)
2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine structure
|
Common Name | 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine | ||
|---|---|---|---|---|
| CAS Number | 61326-00-9 | Molecular Weight | 312.43300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H20N4S |
|---|---|
| Molecular Weight | 312.43300 |
| Exact Mass | 312.14100 |
| PSA | 67.90000 |
| LogP | 1.49850 |
| InChIKey | DLBGDFORVMZNGR-UHFFFAOYSA-N |
| SMILES | CCc1cc2c(s1)Nc1ccccc1N=C2N1CCNCC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![2-ethyl-4-(4-propylpiperazin-1-yl)-5H-thieno[3,2-c][1,5]benzodiazepine structure](https://image.chemsrc.com/caspic/263/74162-50-8.png)
CAS#:74162-50-8This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Ability to block a conditioned avoidance response; Dose administered perorally is 50 ...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL775137
|
|
Name: Cataleptic response in rats
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL773650
|
|
Name: Lethal dose in mice after perorla administration
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL739104
|
|
Name: Hypothermia in mice after peroral administration
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL736898
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: Polar surface area (PSA) of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine is 67.90000. |
| Q: What is the InChIKey of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: InChIKey of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine is DLBGDFORVMZNGR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: Molecular formula of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine is C17H20N4S. |
| Q: What is the molecular weight of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: Molecular weight of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine is 312.43300. |
| Q: What is the LogP of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: LogP of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine is 1.49850. |
| Q: What are the downstream products of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: Related downstream products(CAS) of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine: 74162-50-8. |
| Q: What is the SMILES notation of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: SMILES notation of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine is CCc1cc2c(s1)Nc1ccccc1N=C2N1CCNCC1. |
| Q: What is the English name of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: The English name of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine is 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine. |
| Q: What is the CAS number of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine? |
| A: CAS number of 2-ethyl-4-piperazin-1-yl-5H-thieno[3,2-c][1,5]benzodiazepine is 61326-00-9. |
| Q: What is the Chinese name of 61326-00-9? |
| A: Chinese name of 61326-00-9 is 61326-00-9. |