diethyl 5-methyl-4-oxopyrrolidine-1,3-dicarboxylate structure
|
Common Name | diethyl 5-methyl-4-oxopyrrolidine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 61334-20-1 | Molecular Weight | 243.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 5-methyl-4-oxopyrrolidine-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17NO5 |
|---|---|
| Molecular Weight | 243.25600 |
| Exact Mass | 243.11100 |
| PSA | 72.91000 |
| LogP | 0.53330 |
| InChIKey | RBRMBFSWYUYHPS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(C(=O)OCC)C(C)C1=O |
|
~%
diethyl 5-methy... CAS#:61334-20-1 |
| Literature: Giles, Melvyn; Hadley, Michael S.; Gallagher, Timothy Journal of the Chemical Society, Chemical Communications, 1990 , # 15 p. 1047 - 1048 |
| 1,3-Pyrrolidinedicarboxylic acid,5-methyl-4-oxo-,diethyl ester |
| 5-methyl-4-oxo-pyrrolidine-1,3-dicarboxylic acid diethyl ester |