6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid
6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid structure
|
Common Name | 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 61346-52-9 | Molecular Weight | 254.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14O3 |
|---|---|
| Molecular Weight | 254.28100 |
| Exact Mass | 254.09400 |
| PSA | 46.53000 |
| LogP | 3.59330 |
| InChIKey | IMWQQVFSVKFESB-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCc2ccc(Oc3ccccc3)cc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-phenoxy-2,3-d... CAS#:61346-52-9 |
| Literature: Aono,T. et al. Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, p. 2475 - 2482 |
|
~%
6-phenoxy-2,3-d... CAS#:61346-52-9 |
| Literature: Aono,T. et al. Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, p. 2475 - 2482 |
|
~%
6-phenoxy-2,3-d... CAS#:61346-52-9 |
| Literature: Aono,T. et al. Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, p. 2475 - 2482 |
|
~%
6-phenoxy-2,3-d... CAS#:61346-52-9 |
| Literature: Aono,T. et al. Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, p. 2475 - 2482 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indene-1-carboxylic acid,2,3-dihydro-6-phenoxy |
| 6-Phenyl-1-indancarbonsaeure |
| 6-Phenoxy-1-indancarbonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 61346-52-9? |
| A: Chinese name of 61346-52-9 is 61346-52-9. |
| Q: What is the molecular formula of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid? |
| A: Molecular formula of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid is C16H14O3. |
| Q: What is the LogP of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid? |
| A: LogP of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid is 3.59330. |
| Q: What is the CAS number of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid? |
| A: CAS number of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid is 61346-52-9. |
| Q: What is the polar surface area (PSA) of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid? |
| A: Polar surface area (PSA) of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid is 46.53000. |
| Q: What is the SMILES notation of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid? |
| A: SMILES notation of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid is O=C(O)C1CCc2ccc(Oc3ccccc3)cc21. |
| Q: What is the English name of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid? |
| A: The English name of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid is 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid. |
| Q: What English synonyms does 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid have? |
| A: English synonyms of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid: 1H-Indene-1-carboxylic acid,2,3-dihydro-6-phenoxy, 6-Phenyl-1-indancarbonsaeure, 6-Phenoxy-1-indancarbonsaeure. |
| Q: What is the molecular weight of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid? |
| A: Molecular weight of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid is 254.28100. |
| Q: What is the InChIKey of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid? |
| A: InChIKey of 6-phenoxy-2,3-dihydro-1H-indene-1-carboxylic acid is IMWQQVFSVKFESB-UHFFFAOYSA-N. |