3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate structure
|
Common Name | 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate | ||
|---|---|---|---|---|
| CAS Number | 61346-63-2 | Molecular Weight | 220.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate |
|---|
| Molecular Formula | C13H20N2O |
|---|---|
| Molecular Weight | 220.31100 |
| Exact Mass | 220.15800 |
| PSA | 54.46000 |
| LogP | 3.09986 |
| InChIKey | UNYVPJYPWKZETQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CC=C(CC(=O)C=[N+]=[N-])CC1 |
|
~%
3-(4-tert-butyl... CAS#:61346-63-2 |
| Literature: Smith, Amos B.; Toder, Bruce H.; Branca, Stephen J. Journal of the American Chemical Society, 1984 , vol. 106, # 14 p. 3995 - 4001 |