3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate
3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate structure
|
Common Name | 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate | ||
|---|---|---|---|---|
| CAS Number | 61346-63-2 | Molecular Weight | 220.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20N2O |
|---|---|
| Molecular Weight | 220.31100 |
| Exact Mass | 220.15800 |
| PSA | 54.46000 |
| LogP | 3.09986 |
| InChIKey | UNYVPJYPWKZETQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CC=C(CC(=O)C=[N+]=[N-])CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(4-tert-butyl... CAS#:61346-63-2 |
| Literature: Smith, Amos B.; Toder, Bruce H.; Branca, Stephen J. Journal of the American Chemical Society, 1984 , vol. 106, # 14 p. 3995 - 4001 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate? |
| A: CAS number of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate is 61346-63-2. |
| Q: What is the InChIKey of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate? |
| A: InChIKey of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate is UNYVPJYPWKZETQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate? |
| A: Molecular weight of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate is 220.31100. |
| Q: What is the English name of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate? |
| A: The English name of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate is 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate. |
| Q: What is the Chinese name of 61346-63-2? |
| A: Chinese name of 61346-63-2 is 61346-63-2. |
| Q: What is the SMILES notation of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate? |
| A: SMILES notation of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate is CC(C)(C)C1CC=C(CC(=O)C=[N+]=[N-])CC1. |
| Q: What is the molecular formula of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate? |
| A: Molecular formula of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate is C13H20N2O. |
| Q: What is the polar surface area (PSA) of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate? |
| A: Polar surface area (PSA) of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate is 54.46000. |
| Q: What is the LogP of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate? |
| A: LogP of 3-(4-tert-butylcyclohexen-1-yl)-1-diazonioprop-1-en-2-olate is 3.09986. |