4-benzoyl-5-phenylthiophene-2,3-dione
4-benzoyl-5-phenylthiophene-2,3-dione structure
|
Common Name | 4-benzoyl-5-phenylthiophene-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 61350-68-3 | Molecular Weight | 294.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-benzoyl-5-phenylthiophene-2,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H10O3S |
|---|---|
| Molecular Weight | 294.32500 |
| Exact Mass | 294.03500 |
| PSA | 76.51000 |
| LogP | 3.12310 |
| InChIKey | RQHMTTOMZRTJHY-UHFFFAOYSA-N |
| SMILES | O=C1SC(c2ccccc2)=C(C(=O)c2ccccc2)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~68%
4-benzoyl-5-phe... CAS#:61350-68-3 |
| Literature: Kollenz; Terpetschnig; Sterk; Peters Tetrahedron, 1999 , vol. 55, # 10 p. 2973 - 2984 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3-Thiophenedione,4-benzoyl-5-phenyl |
| 4-benzoyl-5-phenyl-thiophene-2,3-dione |
| 4-Benzoyl-2,3-dioxo-5-phenyl-2,3-dihydrothiophen |
| 4-benzoyl-5-phenyl-2,3-thiophenedione |
| 4-benzoyl-2,3-dihydro-5-phenylthiophene-2,3-dione |
| 4-Benzoyl-5-phenylthiophen-2,3-dion |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-benzoyl-5-phenylthiophene-2,3-dione have? |
| A: English synonyms of 4-benzoyl-5-phenylthiophene-2,3-dione: 2,3-Thiophenedione,4-benzoyl-5-phenyl, 4-benzoyl-5-phenyl-thiophene-2,3-dione, 4-Benzoyl-2,3-dioxo-5-phenyl-2,3-dihydrothiophen, 4-benzoyl-5-phenyl-2,3-thiophenedione, 4-benzoyl-2,3-dihydro-5-phenylthiophene-2,3-dione, 4-Benzoyl-5-phenylthiophen-2,3-dion. |
| Q: What is the CAS number of 4-benzoyl-5-phenylthiophene-2,3-dione? |
| A: CAS number of 4-benzoyl-5-phenylthiophene-2,3-dione is 61350-68-3. |
| Q: What is the molecular formula of 4-benzoyl-5-phenylthiophene-2,3-dione? |
| A: Molecular formula of 4-benzoyl-5-phenylthiophene-2,3-dione is C17H10O3S. |
| Q: What is the Chinese name of 61350-68-3? |
| A: Chinese name of 61350-68-3 is 61350-68-3. |
| Q: What is the InChIKey of 4-benzoyl-5-phenylthiophene-2,3-dione? |
| A: InChIKey of 4-benzoyl-5-phenylthiophene-2,3-dione is RQHMTTOMZRTJHY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-benzoyl-5-phenylthiophene-2,3-dione? |
| A: SMILES notation of 4-benzoyl-5-phenylthiophene-2,3-dione is O=C1SC(c2ccccc2)=C(C(=O)c2ccccc2)C1=O. |
| Q: What is the molecular weight of 4-benzoyl-5-phenylthiophene-2,3-dione? |
| A: Molecular weight of 4-benzoyl-5-phenylthiophene-2,3-dione is 294.32500. |
| Q: What is the LogP of 4-benzoyl-5-phenylthiophene-2,3-dione? |
| A: LogP of 4-benzoyl-5-phenylthiophene-2,3-dione is 3.12310. |
| Q: What is the polar surface area (PSA) of 4-benzoyl-5-phenylthiophene-2,3-dione? |
| A: Polar surface area (PSA) of 4-benzoyl-5-phenylthiophene-2,3-dione is 76.51000. |
| Q: What is the English name of 4-benzoyl-5-phenylthiophene-2,3-dione? |
| A: The English name of 4-benzoyl-5-phenylthiophene-2,3-dione is 4-benzoyl-5-phenylthiophene-2,3-dione. |