4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione
4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione structure
|
Common Name | 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 61350-69-4 | Molecular Weight | 277.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H11NO3 |
|---|---|
| Molecular Weight | 277.27400 |
| Exact Mass | 277.07400 |
| PSA | 63.24000 |
| LogP | 2.30830 |
| InChIKey | UAIUTDUNHTZTAM-UHFFFAOYSA-N |
| SMILES | O=C1N=C(c2ccccc2)C(=C(O)c2ccccc2)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~74%
4-benzoyl-5-phe... CAS#:61350-69-4 |
| Literature: Kollenz; Terpetschnig; Sterk; Peters Tetrahedron, 1999 , vol. 55, # 10 p. 2973 - 2984 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-benzoyl-5-phenyl-pyrrole-2,3-dione |
| 4-Benzoyl-2,3-dioxo-5-phenyl-2,3-dihydropyrrol |
| 1H-Pyrrole-2,3-dione,4-benzoyl-5-phenyl |
| 4-benzoyl-2,3-dihydro-1H-5-phenylpyrrole-2,3-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione? |
| A: Molecular formula of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione is C17H11NO3. |
| Q: What is the polar surface area (PSA) of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione? |
| A: Polar surface area (PSA) of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione is 63.24000. |
| Q: What is the molecular weight of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione? |
| A: Molecular weight of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione is 277.27400. |
| Q: What is the InChIKey of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione? |
| A: InChIKey of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione is UAIUTDUNHTZTAM-UHFFFAOYSA-N. |
| Q: What is the English name of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione? |
| A: The English name of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione is 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione. |
| Q: What is the CAS number of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione? |
| A: CAS number of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione is 61350-69-4. |
| Q: What is the Chinese name of 61350-69-4? |
| A: Chinese name of 61350-69-4 is 61350-69-4. |
| Q: What English synonyms does 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione have? |
| A: English synonyms of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione: 4-benzoyl-5-phenyl-pyrrole-2,3-dione, 4-Benzoyl-2,3-dioxo-5-phenyl-2,3-dihydropyrrol, 1H-Pyrrole-2,3-dione,4-benzoyl-5-phenyl, 4-benzoyl-2,3-dihydro-1H-5-phenylpyrrole-2,3-dione. |
| Q: What is the LogP of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione? |
| A: LogP of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione is 2.30830. |
| Q: What is the SMILES notation of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione? |
| A: SMILES notation of 4-benzoyl-5-phenyl-1H-pyrrole-2,3-dione is O=C1N=C(c2ccccc2)C(=C(O)c2ccccc2)C1=O. |