4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione
4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione structure
|
Common Name | 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 61350-70-7 | Molecular Weight | 359.41800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H21NO3 |
|---|---|
| Molecular Weight | 359.41800 |
| Exact Mass | 359.15200 |
| PSA | 54.45000 |
| LogP | 3.96250 |
| InChIKey | CJKCXJLSCMXXCL-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)N(C2CCCCC2)C(c2ccccc2)=C1C(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~27%
4-benzoyl-1-cyc... CAS#:61350-70-7 |
| Literature: Kollenz, Gert; Penn, Gerhard; Dolenz, Gerhard; Akcamur,Yunus; Peters, Karl; et al. Chemische Berichte, 1984 , vol. 117, # 4 p. 1299 - 1309 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Benzoyl-1-cyclohexyl-5-phenyl-1H-pyrrol-2,3-dion |
| 1H-Pyrrole-2,3-dione,4-benzoyl-1-cyclohexyl-5-phenyl |
| 4-benzoyl-1-cyclohexyl-5-phenyl-pyrrole-2,3-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione? |
| A: Molecular formula of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione is C23H21NO3. |
| Q: What is the CAS number of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione? |
| A: CAS number of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione is 61350-70-7. |
| Q: What is the LogP of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione? |
| A: LogP of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione is 3.96250. |
| Q: What English synonyms does 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione have? |
| A: English synonyms of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione: 4-Benzoyl-1-cyclohexyl-5-phenyl-1H-pyrrol-2,3-dion, 1H-Pyrrole-2,3-dione,4-benzoyl-1-cyclohexyl-5-phenyl, 4-benzoyl-1-cyclohexyl-5-phenyl-pyrrole-2,3-dione. |
| Q: What is the SMILES notation of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione? |
| A: SMILES notation of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione is O=C1C(=O)N(C2CCCCC2)C(c2ccccc2)=C1C(=O)c1ccccc1. |
| Q: What is the polar surface area (PSA) of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione? |
| A: Polar surface area (PSA) of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione is 54.45000. |
| Q: What is the molecular weight of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione? |
| A: Molecular weight of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione is 359.41800. |
| Q: What is the InChIKey of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione? |
| A: InChIKey of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione is CJKCXJLSCMXXCL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 61350-70-7? |
| A: Chinese name of 61350-70-7 is 61350-70-7. |
| Q: What is the English name of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione? |
| A: The English name of 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione is 4-benzoyl-1-cyclohexyl-5-phenylpyrrole-2,3-dione. |