2-thiophen-2-yl-1,3-benzothiazol-5-amine
2-thiophen-2-yl-1,3-benzothiazol-5-amine structure
|
Common Name | 2-thiophen-2-yl-1,3-benzothiazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 61352-32-7 | Molecular Weight | 232.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-thiophen-2-yl-1,3-benzothiazol-5-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8N2S2 |
|---|---|
| Molecular Weight | 232.32500 |
| Exact Mass | 232.01300 |
| PSA | 95.39000 |
| LogP | 4.18820 |
| InChIKey | ZOZFHJPGYFCYMZ-UHFFFAOYSA-N |
| SMILES | Nc1ccc2sc(-c3cccs3)nc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-thiophen-2-yl... CAS#:61352-32-7 |
| Literature: Haugwitz; Angel; Jacobs; Maurer; Narayanan; Cruthers; Szanto Journal of Medicinal Chemistry, 1982 , vol. 25, # 8 p. 969 - 974 |
|
~%
2-thiophen-2-yl... CAS#:61352-32-7 |
| Literature: Haugwitz; Angel; Jacobs; Maurer; Narayanan; Cruthers; Szanto Journal of Medicinal Chemistry, 1982 , vol. 25, # 8 p. 969 - 974 |
|
~%
2-thiophen-2-yl... CAS#:61352-32-7 |
| Literature: Haugwitz; Angel; Jacobs; Maurer; Narayanan; Cruthers; Szanto Journal of Medicinal Chemistry, 1982 , vol. 25, # 8 p. 969 - 974 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-thiophen-2-yl-1,3-benzothiazol-5-amine? |
| A: LogP of 2-thiophen-2-yl-1,3-benzothiazol-5-amine is 4.18820. |
| Q: What is the Chinese name of 61352-32-7? |
| A: Chinese name of 61352-32-7 is 61352-32-7. |
| Q: What is the molecular weight of 2-thiophen-2-yl-1,3-benzothiazol-5-amine? |
| A: Molecular weight of 2-thiophen-2-yl-1,3-benzothiazol-5-amine is 232.32500. |
| Q: What is the English name of 2-thiophen-2-yl-1,3-benzothiazol-5-amine? |
| A: The English name of 2-thiophen-2-yl-1,3-benzothiazol-5-amine is 2-thiophen-2-yl-1,3-benzothiazol-5-amine. |
| Q: What is the SMILES notation of 2-thiophen-2-yl-1,3-benzothiazol-5-amine? |
| A: SMILES notation of 2-thiophen-2-yl-1,3-benzothiazol-5-amine is Nc1ccc2sc(-c3cccs3)nc2c1. |
| Q: What is the molecular formula of 2-thiophen-2-yl-1,3-benzothiazol-5-amine? |
| A: Molecular formula of 2-thiophen-2-yl-1,3-benzothiazol-5-amine is C11H8N2S2. |
| Q: What is the CAS number of 2-thiophen-2-yl-1,3-benzothiazol-5-amine? |
| A: CAS number of 2-thiophen-2-yl-1,3-benzothiazol-5-amine is 61352-32-7. |
| Q: What is the polar surface area (PSA) of 2-thiophen-2-yl-1,3-benzothiazol-5-amine? |
| A: Polar surface area (PSA) of 2-thiophen-2-yl-1,3-benzothiazol-5-amine is 95.39000. |
| Q: What is the InChIKey of 2-thiophen-2-yl-1,3-benzothiazol-5-amine? |
| A: InChIKey of 2-thiophen-2-yl-1,3-benzothiazol-5-amine is ZOZFHJPGYFCYMZ-UHFFFAOYSA-N. |