1-[(4-methylphenyl)-phenylmethyl]-3-phenylthiourea
Modify Date: 2025-09-20 23:16:30
![1-[(4-methylphenyl)-phenylmethyl]-3-phenylthiourea Structure](https://image.chemsrc.com/caspic/361/61353-90-0.png)
1-[(4-methylphenyl)-phenylmethyl]-3-phenylthiourea structure
|
Common Name | 1-[(4-methylphenyl)-phenylmethyl]-3-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 61353-90-0 | Molecular Weight | 332.46200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(4-methylphenyl)-phenylmethyl]-3-phenylthiourea |
|---|
| Molecular Formula | C21H20N2S |
|---|---|
| Molecular Weight | 332.46200 |
| Exact Mass | 332.13500 |
| PSA | 63.19000 |
| LogP | 5.68240 |
| InChIKey | WIQAXQGWELDZKW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(NC(=S)Nc2ccccc2)c2ccccc2)cc1 |
|
~%
1-[(4-methylphe... CAS#:61353-90-0 |
| Literature: Wheeler; Jamieson Journal of the American Chemical Society, 1902 , vol. 24, p. 753 |
|
~%
1-[(4-methylphe... CAS#:61353-90-0 |
| Literature: Wheeler; Jamieson Journal of the American Chemical Society, 1902 , vol. 24, p. 753 |
