methyl 4-methyl-3-phenylpenta-2,4-dienoate
methyl 4-methyl-3-phenylpenta-2,4-dienoate structure
|
Common Name | methyl 4-methyl-3-phenylpenta-2,4-dienoate | ||
|---|---|---|---|---|
| CAS Number | 61354-46-9 | Molecular Weight | 202.24900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4-methyl-3-phenylpenta-2,4-dienoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14O2 |
|---|---|
| Molecular Weight | 202.24900 |
| Exact Mass | 202.09900 |
| PSA | 26.30000 |
| LogP | 2.81910 |
| InChIKey | MTNCQRIFHHEHRS-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=CC(=O)OC)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~29%
methyl 4-methyl... CAS#:61354-46-9
Learn More
|
| Literature: Padwa, Albert; Kennedy, G. Davon Journal of Organic Chemistry, 1984 , vol. 49, # 23 p. 4344 - 4352 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-Pentadienoic acid,4-methyl-3-phenyl-,methyl ester |
| 3-Phenyl-4-methyl-2,4-pentadiensaeure-methylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of methyl 4-methyl-3-phenylpenta-2,4-dienoate? |
| A: LogP of methyl 4-methyl-3-phenylpenta-2,4-dienoate is 2.81910. |
| Q: What is the Chinese name of 61354-46-9? |
| A: Chinese name of 61354-46-9 is 61354-46-9. |
| Q: What is the CAS number of methyl 4-methyl-3-phenylpenta-2,4-dienoate? |
| A: CAS number of methyl 4-methyl-3-phenylpenta-2,4-dienoate is 61354-46-9. |
| Q: What is the InChIKey of methyl 4-methyl-3-phenylpenta-2,4-dienoate? |
| A: InChIKey of methyl 4-methyl-3-phenylpenta-2,4-dienoate is MTNCQRIFHHEHRS-UHFFFAOYSA-N. |
| Q: What is the English name of methyl 4-methyl-3-phenylpenta-2,4-dienoate? |
| A: The English name of methyl 4-methyl-3-phenylpenta-2,4-dienoate is methyl 4-methyl-3-phenylpenta-2,4-dienoate. |
| Q: What is the molecular weight of methyl 4-methyl-3-phenylpenta-2,4-dienoate? |
| A: Molecular weight of methyl 4-methyl-3-phenylpenta-2,4-dienoate is 202.24900. |
| Q: What English synonyms does methyl 4-methyl-3-phenylpenta-2,4-dienoate have? |
| A: English synonyms of methyl 4-methyl-3-phenylpenta-2,4-dienoate: 2,4-Pentadienoic acid,4-methyl-3-phenyl-,methyl ester, 3-Phenyl-4-methyl-2,4-pentadiensaeure-methylester. |
| Q: What is the polar surface area (PSA) of methyl 4-methyl-3-phenylpenta-2,4-dienoate? |
| A: Polar surface area (PSA) of methyl 4-methyl-3-phenylpenta-2,4-dienoate is 26.30000. |
| Q: What is the molecular formula of methyl 4-methyl-3-phenylpenta-2,4-dienoate? |
| A: Molecular formula of methyl 4-methyl-3-phenylpenta-2,4-dienoate is C13H14O2. |
| Q: What is the SMILES notation of methyl 4-methyl-3-phenylpenta-2,4-dienoate? |
| A: SMILES notation of methyl 4-methyl-3-phenylpenta-2,4-dienoate is C=C(C)C(=CC(=O)OC)c1ccccc1. |