N-benzyl-N-(2-oxopropyl)acetamide
N-benzyl-N-(2-oxopropyl)acetamide structure
|
Common Name | N-benzyl-N-(2-oxopropyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 61357-16-2 | Molecular Weight | 205.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-N-(2-oxopropyl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15NO2 |
|---|---|
| Molecular Weight | 205.25300 |
| Exact Mass | 205.11000 |
| PSA | 37.38000 |
| LogP | 1.62410 |
| InChIKey | WHOMALFADXYJII-UHFFFAOYSA-N |
| SMILES | CC(=O)CN(Cc1ccccc1)C(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~76%
N-benzyl-N-(2-o... CAS#:61357-16-2 |
| Literature: Oh, Byoung Ho; Nakamura, Itaru; Yamamoto, Yoshinori Journal of Organic Chemistry, 2004 , vol. 69, # 8 p. 2856 - 2858 |
|
~%
N-benzyl-N-(2-o... CAS#:61357-16-2 |
| Literature: Sato, Tadashi; Matsuoka, Hiroharu; Igarashi, Tsutomu; Minomura, Masafumi; Murayama, Eigoro Journal of Organic Chemistry, 1988 , vol. 53, # 6 p. 1207 - 1212 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-benzyl-N-(2-oxopropyl)acetamide? |
| A: CAS number of N-benzyl-N-(2-oxopropyl)acetamide is 61357-16-2. |
| Q: What is the polar surface area (PSA) of N-benzyl-N-(2-oxopropyl)acetamide? |
| A: Polar surface area (PSA) of N-benzyl-N-(2-oxopropyl)acetamide is 37.38000. |
| Q: What is the Chinese name of 61357-16-2? |
| A: Chinese name of 61357-16-2 is 61357-16-2. |
| Q: What is the SMILES notation of N-benzyl-N-(2-oxopropyl)acetamide? |
| A: SMILES notation of N-benzyl-N-(2-oxopropyl)acetamide is CC(=O)CN(Cc1ccccc1)C(C)=O. |
| Q: What is the InChIKey of N-benzyl-N-(2-oxopropyl)acetamide? |
| A: InChIKey of N-benzyl-N-(2-oxopropyl)acetamide is WHOMALFADXYJII-UHFFFAOYSA-N. |
| Q: What is the LogP of N-benzyl-N-(2-oxopropyl)acetamide? |
| A: LogP of N-benzyl-N-(2-oxopropyl)acetamide is 1.62410. |
| Q: What is the molecular formula of N-benzyl-N-(2-oxopropyl)acetamide? |
| A: Molecular formula of N-benzyl-N-(2-oxopropyl)acetamide is C12H15NO2. |
| Q: What is the English name of N-benzyl-N-(2-oxopropyl)acetamide? |
| A: The English name of N-benzyl-N-(2-oxopropyl)acetamide is N-benzyl-N-(2-oxopropyl)acetamide. |
| Q: What is the molecular weight of N-benzyl-N-(2-oxopropyl)acetamide? |
| A: Molecular weight of N-benzyl-N-(2-oxopropyl)acetamide is 205.25300. |