methyl N-[4-(4-methoxyphenyl)butyl]carbamate
![methyl N-[4-(4-methoxyphenyl)butyl]carbamate Structure](https://image.chemsrc.com/caspic/198/61357-26-4.png)
methyl N-[4-(4-methoxyphenyl)butyl]carbamate structure
|
Common Name | methyl N-[4-(4-methoxyphenyl)butyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 61357-26-4 | Molecular Weight | 237.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl N-[4-(4-methoxyphenyl)butyl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO3 |
|---|---|
| Molecular Weight | 237.29500 |
| Exact Mass | 237.13600 |
| PSA | 51.05000 |
| LogP | 2.57830 |
| InChIKey | GETQMSYYWJMOFP-UHFFFAOYSA-N |
| SMILES | COC(=O)NCCCCc1ccc(OC)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
methyl N-[4-(4-... CAS#:61357-26-4 |
| Literature: Mori,M.; Ban,Y. Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, p. 1992 - 1999 |
|
~%
methyl N-[4-(4-... CAS#:61357-26-4 |
| Literature: Mori,M.; Ban,Y. Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, p. 1992 - 1999 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of methyl N-[4-(4-methoxyphenyl)butyl]carbamate? |
| A: InChIKey of methyl N-[4-(4-methoxyphenyl)butyl]carbamate is GETQMSYYWJMOFP-UHFFFAOYSA-N. |
| Q: What is the CAS number of methyl N-[4-(4-methoxyphenyl)butyl]carbamate? |
| A: CAS number of methyl N-[4-(4-methoxyphenyl)butyl]carbamate is 61357-26-4. |
| Q: What is the Chinese name of 61357-26-4? |
| A: Chinese name of 61357-26-4 is 61357-26-4. |
| Q: What is the molecular weight of methyl N-[4-(4-methoxyphenyl)butyl]carbamate? |
| A: Molecular weight of methyl N-[4-(4-methoxyphenyl)butyl]carbamate is 237.29500. |
| Q: What is the polar surface area (PSA) of methyl N-[4-(4-methoxyphenyl)butyl]carbamate? |
| A: Polar surface area (PSA) of methyl N-[4-(4-methoxyphenyl)butyl]carbamate is 51.05000. |
| Q: What is the SMILES notation of methyl N-[4-(4-methoxyphenyl)butyl]carbamate? |
| A: SMILES notation of methyl N-[4-(4-methoxyphenyl)butyl]carbamate is COC(=O)NCCCCc1ccc(OC)cc1. |
| Q: What is the molecular formula of methyl N-[4-(4-methoxyphenyl)butyl]carbamate? |
| A: Molecular formula of methyl N-[4-(4-methoxyphenyl)butyl]carbamate is C13H19NO3. |
| Q: What is the LogP of methyl N-[4-(4-methoxyphenyl)butyl]carbamate? |
| A: LogP of methyl N-[4-(4-methoxyphenyl)butyl]carbamate is 2.57830. |
| Q: What is the English name of methyl N-[4-(4-methoxyphenyl)butyl]carbamate? |
| A: The English name of methyl N-[4-(4-methoxyphenyl)butyl]carbamate is methyl N-[4-(4-methoxyphenyl)butyl]carbamate. |