5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one
Modify Date: 2026-08-11 10:12:26
5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one structure
|
Common Name | 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 61357-61-7 | Molecular Weight | 258.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H22O2 |
|---|---|
| Molecular Weight | 258.35500 |
| Exact Mass | 258.16200 |
| PSA | 26.30000 |
| LogP | 4.25660 |
| InChIKey | KUGVIKRXUFFUCK-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(C)c(C)c2c1C(C)C(C)=C(C)C2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one? |
| A: Polar surface area (PSA) of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one is 26.30000. |
| Q: What is the CAS number of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one? |
| A: CAS number of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one is 61357-61-7. |
| Q: What is the SMILES notation of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one? |
| A: SMILES notation of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one is COc1c(C)c(C)c(C)c2c1C(C)C(C)=C(C)C2=O. |
| Q: What is the English name of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one? |
| A: The English name of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one is 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one. |
| Q: What is the molecular weight of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one? |
| A: Molecular weight of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one is 258.35500. |
| Q: What is the LogP of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one? |
| A: LogP of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one is 4.25660. |
| Q: What is the InChIKey of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one? |
| A: InChIKey of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one is KUGVIKRXUFFUCK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 61357-61-7? |
| A: Chinese name of 61357-61-7 is 61357-61-7. |
| Q: What is the molecular formula of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one? |
| A: Molecular formula of 5-methoxy-2,3,4,6,7,8-hexamethyl-4H-naphthalen-1-one is C17H22O2. |