3-Ethoxybenzophenone structure
|
Common Name | 3-Ethoxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 6136-67-0 | Molecular Weight | 212.24400 | |
| Density | 1.108g/cm3 | Boiling Point | 348.328ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.034ºC | |
| Name | (3-methoxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 348.328ºC at 760 mmHg |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 158.034ºC |
| Exact Mass | 212.08400 |
| PSA | 26.30000 |
| LogP | 2.92620 |
| Index of Refraction | 1.569 |
| InChIKey | VMFJVWPCRCAWBS-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)c2ccccc2)c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-METHOXYBENZOPHENONE |
| (3-methoxyphenylcarbonyl)benzene |
| PhCO(m-MeOPh) |
| (3-methoxyphenyl)(phenyl)methanone |
| 3-Methoxy-benzophenon |