1,2,3,3-tetramethyl-6-nitro-2H-indole structure
|
Common Name | 1,2,3,3-tetramethyl-6-nitro-2H-indole | ||
|---|---|---|---|---|
| CAS Number | 61360-89-2 | Molecular Weight | 220.26800 | |
| Density | 1.102g/cm3 | Boiling Point | 322.1ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.6ºC | |
| Name | 1,2,3,3-tetramethyl-6-nitro-2H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 322.1ºC at 760 mmHg |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.26800 |
| Flash Point | 148.6ºC |
| Exact Mass | 220.12100 |
| PSA | 49.06000 |
| LogP | 3.29890 |
| Index of Refraction | 1.539 |
| InChIKey | BYHFGPIICGZZNB-UHFFFAOYSA-N |
| SMILES | CC1N(C)c2cc([N+](=O)[O-])ccc2C1(C)C |
|
~68%
1,2,3,3-tetrame... CAS#:61360-89-2 |
| Literature: Tolmachev, A. A.; Tolmacheva, V. S.; Shevchuk, L. I.; Kozlov, E. S.; Babichev, F. S. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1989 , vol. 25, # 7 p. 764 - 767 Khimiya Geterotsiklicheskikh Soedinenii, 1989 , # 7 p. 919 - 923 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 6-Nitro-1,2,3,3-tetramethylindoline |
| 1,2,3,3-tetramethyl-6-nitroindoline |