prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate
![prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate Structure](https://image.chemsrc.com/caspic/232/61363-98-2.png)
prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate structure
|
Common Name | prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate | ||
|---|---|---|---|---|
| CAS Number | 61363-98-2 | Molecular Weight | 273.11500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10Cl2N2O2 |
|---|---|
| Molecular Weight | 273.11500 |
| Exact Mass | 272.01200 |
| PSA | 50.69000 |
| LogP | 3.10640 |
| InChIKey | HEXJPSNFKGNFJX-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C(Cl)=NNc1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
prop-2-enyl 2-c... CAS#:61363-98-2 |
| Literature: Garanti,L. et al. Journal of Organic Chemistry, 1977 , vol. 42, # 8 p. 1389 - 1392 |
|
~%
prop-2-enyl 2-c... CAS#:61363-98-2 |
| Literature: Garanti,L. et al. Journal of Organic Chemistry, 1977 , vol. 42, # 8 p. 1389 - 1392 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate? |
| A: InChIKey of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate is HEXJPSNFKGNFJX-UHFFFAOYSA-N. |
| Q: What is the CAS number of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate? |
| A: CAS number of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate is 61363-98-2. |
| Q: What is the LogP of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate? |
| A: LogP of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate is 3.10640. |
| Q: What is the Chinese name of 61363-98-2? |
| A: Chinese name of 61363-98-2 is 61363-98-2. |
| Q: What is the molecular weight of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate? |
| A: Molecular weight of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate is 273.11500. |
| Q: What is the SMILES notation of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate? |
| A: SMILES notation of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate is C=CCOC(=O)C(Cl)=NNc1ccc(Cl)cc1. |
| Q: What is the polar surface area (PSA) of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate? |
| A: Polar surface area (PSA) of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate is 50.69000. |
| Q: What is the molecular formula of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate? |
| A: Molecular formula of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate is C11H10Cl2N2O2. |
| Q: What is the English name of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate? |
| A: The English name of prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate is prop-2-enyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate. |