1-(3-(methylamino)-propyl)-5-methyl-3-phenyl-1H-indazole
Modify Date: 2025-08-23 11:18:34
1-(3-(methylamino)-propyl)-5-methyl-3-phenyl-1H-indazole structure
|
Common Name | 1-(3-(methylamino)-propyl)-5-methyl-3-phenyl-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 61365-76-2 | Molecular Weight | 279.37900 | |
| Density | 1.09g/cm3 | Boiling Point | 457.8ºC at 760 mmHg | |
| Molecular Formula | C18H21N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.7ºC | |
| Name | N-methyl-3-(5-methyl-3-phenylindazol-1-yl)propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 457.8ºC at 760 mmHg |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.37900 |
| Flash Point | 230.7ºC |
| Exact Mass | 279.17400 |
| PSA | 29.85000 |
| LogP | 4.01210 |
| Index of Refraction | 1.601 |
| InChIKey | QBDZVHMKMOSZPU-UHFFFAOYSA-N |
| SMILES | CNCCCn1nc(-c2ccccc2)c2cc(C)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-1-propanamine,N,5-dimethyl-3-phenyl |
| FS-97 |