[5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone
![[5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone Structure](https://image.chemsrc.com/caspic/275/613661-02-2.png)
[5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone structure
|
Common Name | [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 613661-02-2 | Molecular Weight | 256.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16N2O2 |
|---|---|
| Molecular Weight | 256.30000 |
| Exact Mass | 256.12100 |
| PSA | 46.34000 |
| LogP | 2.90400 |
| InChIKey | QOAKTYANPVSSFQ-UHFFFAOYSA-N |
| SMILES | CC1CCCN1C(=O)c1cncc(-c2ccoc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[5-(furan-3-yl)... CAS#:613661-02-2 |
| Literature: Haviv, Fortuna; Brandley, Michael F.; Henkin, Jack Patent: US2003/195192 A1, 2003 ; |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 613661-02-2? |
| A: Chinese name of 613661-02-2 is 613661-02-2. |
| Q: What is the English name of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone? |
| A: The English name of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone is [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone. |
| Q: What is the LogP of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone? |
| A: LogP of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone is 2.90400. |
| Q: What is the CAS number of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone? |
| A: CAS number of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone is 613661-02-2. |
| Q: What is the molecular formula of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone? |
| A: Molecular formula of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone is C15H16N2O2. |
| Q: What is the polar surface area (PSA) of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone? |
| A: Polar surface area (PSA) of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone is 46.34000. |
| Q: What is the SMILES notation of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone? |
| A: SMILES notation of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone is CC1CCCN1C(=O)c1cncc(-c2ccoc2)c1. |
| Q: What is the molecular weight of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone? |
| A: Molecular weight of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone is 256.30000. |
| Q: What is the InChIKey of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone? |
| A: InChIKey of [5-(furan-3-yl)pyridin-3-yl]-(2-methylpyrrolidin-1-yl)methanone is QOAKTYANPVSSFQ-UHFFFAOYSA-N. |