Urea,N-[4-[(acetyloxy)methyl]cyclohexyl]-N'-(2-fluoroethyl)-, trans- (9CI)
![Urea,N-[4-[(acetyloxy)methyl]cyclohexyl]-N'-(2-fluoroethyl)-, trans- (9CI) Structure](https://image.chemsrc.com/caspic/204/61367-13-3.png)
Urea,N-[4-[(acetyloxy)methyl]cyclohexyl]-N'-(2-fluoroethyl)-, trans- (9CI) structure
|
Common Name | Urea,N-[4-[(acetyloxy)methyl]cyclohexyl]-N'-(2-fluoroethyl)-, trans- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 61367-13-3 | Molecular Weight | 260.30500 | |
| Density | 1.13g/cm3 | Boiling Point | 419.6ºC at 760 mmHg | |
| Molecular Formula | C12H21FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 419.6ºC at 760 mmHg |
| Molecular Formula | C12H21FN2O3 |
| Molecular Weight | 260.30500 |
| Flash Point | 207.6ºC |
| Exact Mass | 260.15400 |
| PSA | 67.43000 |
| LogP | 2.15880 |
| Index of Refraction | 1.475 |
| InChIKey | LEPJAWIKPTXBTB-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1CCC(NC(=O)NCCF)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Urea,N-[4-[(ace... CAS#:61367-13-3 |
| Literature: Johnston; McCaleb; Clayton; Frye; Krauth; Montgomery Journal of Medicinal Chemistry, 1977 , vol. 20, # 2 p. 279 - 290 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![[4-[(2-fluoroethyl-nitroso-carbamoyl)amino]cyclohexyl]methyl acetate structure](https://image.chemsrc.com/caspic/457/61137-53-9.png)
CAS#:61137-53-9This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: Molecular formula of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate is C12H21FN2O3. |
| Q: What is the molecular weight of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: Molecular weight of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate is 260.30500. |
| Q: What is the Chinese name of 61367-13-3? |
| A: Chinese name of 61367-13-3 is 61367-13-3. |
| Q: What are the downstream products of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: Related downstream products(CAS) of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate: 61137-53-9. |
| Q: What is the SMILES notation of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: SMILES notation of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate is CC(=O)OCC1CCC(NC(=O)NCCF)CC1. |
| Q: What is the boiling point of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: Boiling point of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate is 419.6ºC at 760 mmHg. |
| Q: What is the English name of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: The English name of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate is [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate. |
| Q: What are the upstream materials of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: Related upstream materials(CAS) of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate: 13908-88-8;61367-09-7. |
| Q: What is the InChIKey of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: InChIKey of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate is LEPJAWIKPTXBTB-UHFFFAOYSA-N. |
| Q: What is the LogP of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate? |
| A: LogP of [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate is 2.15880. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |