Urea,N-[4-[(acetyloxy)methyl]cyclohexyl]-N'-(2-fluoroethyl)-, trans- (9CI) structure
|
Common Name | Urea,N-[4-[(acetyloxy)methyl]cyclohexyl]-N'-(2-fluoroethyl)-, trans- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 61367-13-3 | Molecular Weight | 260.30500 | |
| Density | 1.13g/cm3 | Boiling Point | 419.6ºC at 760 mmHg | |
| Molecular Formula | C12H21FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | [4-(2-fluoroethylcarbamoylamino)cyclohexyl]methyl acetate |
|---|
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 419.6ºC at 760 mmHg |
| Molecular Formula | C12H21FN2O3 |
| Molecular Weight | 260.30500 |
| Flash Point | 207.6ºC |
| Exact Mass | 260.15400 |
| PSA | 67.43000 |
| LogP | 2.15880 |
| Index of Refraction | 1.475 |
| InChIKey | LEPJAWIKPTXBTB-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1CCC(NC(=O)NCCF)CC1 |
|
~%
Urea,N-[4-[(ace... CAS#:61367-13-3 |
| Literature: Johnston; McCaleb; Clayton; Frye; Krauth; Montgomery Journal of Medicinal Chemistry, 1977 , vol. 20, # 2 p. 279 - 290 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |