4-(2-fluoroethylcarbamoylamino)cyclohexane-1-carboxylic acid structure
|
Common Name | 4-(2-fluoroethylcarbamoylamino)cyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 61367-20-2 | Molecular Weight | 232.25200 | |
| Density | 1.22g/cm3 | Boiling Point | 482.5ºC at 760 mmHg | |
| Molecular Formula | C10H17FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.6ºC | |
| Name | 4-(2-fluoroethylcarbamoylamino)cyclohexane-1-carboxylic acid |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 482.5ºC at 760 mmHg |
| Molecular Formula | C10H17FN2O3 |
| Molecular Weight | 232.25200 |
| Flash Point | 245.6ºC |
| Exact Mass | 232.12200 |
| PSA | 78.43000 |
| LogP | 1.68030 |
| Index of Refraction | 1.498 |
| InChIKey | HEJSMKSZULWJQU-UHFFFAOYSA-N |
| SMILES | O=C(NCCF)NC1CCC(C(=O)O)CC1 |
|
~%
4-(2-fluoroethy... CAS#:61367-20-2 |
| Literature: Johnston; McCaleb; Clayton; Frye; Krauth; Montgomery Journal of Medicinal Chemistry, 1977 , vol. 20, # 2 p. 279 - 290 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |