2-(4-Isopropoxy-3,5-Dimethoxyphenyl)Ethan-1-Amine Hydrochloride
Modify Date: 2025-11-10 16:18:18
2-(4-Isopropoxy-3,5-Dimethoxyphenyl)Ethan-1-Amine Hydrochloride structure
|
Common Name | 2-(4-Isopropoxy-3,5-Dimethoxyphenyl)Ethan-1-Amine Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 61367-70-2 | Molecular Weight | 275.77200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,5-dimethoxy-4-propan-2-yloxyphenyl)ethanamine,hydrochloride |
|---|
| Molecular Formula | C13H22ClNO3 |
|---|---|
| Molecular Weight | 275.77200 |
| Exact Mass | 275.12900 |
| PSA | 53.71000 |
| LogP | 3.49450 |
| InChIKey | GURNWYXOAVSCDU-UHFFFAOYSA-N |
| SMILES | COc1cc(CCN)cc(OC)c1OC(C)C.Cl |
|
Name: Potency ratio, ratio of mescaline ED50 to compound ED50 for serotonin receptor in she...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3285115
|
|
Name: Agonist activity at serotonin receptor in sheep umbilical artery assessed increase of...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3285114
|
|
Name: 1-Octanol-water partition coefficient, log P of the compound at pH 8
Source: ChEMBL
Target: N/A
External Id: CHEMBL3285116
|
Total 3, Current Page 1 of 1
1