bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane
bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane structure
|
Common Name | bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 61368-85-2 | Molecular Weight | 496.53500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H21O5PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H21O5PS2 |
|---|---|
| Molecular Weight | 496.53500 |
| Exact Mass | 496.05700 |
| PSA | 115.08000 |
| LogP | 5.75910 |
| InChIKey | ZYVDIFBEGDJFER-UHFFFAOYSA-N |
| SMILES | O=S(=O)(C(=P(O)(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bis(benzenesulf... CAS#:61368-85-2 |
| Literature: Kolodyazhnyi, O. I. J. Gen. Chem. USSR (Engl. Transl.), 1982 , vol. 52, # 7 p. 1538 - 1543,1358 - 1363 |
![[bis(benzenesulfonyl)methyl-phenylphosphoryl]benzene structure](https://image.chemsrc.com/caspic/437/61368-82-9.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane? |
| A: The English name of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane is bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane. |
| Q: What is the LogP of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane? |
| A: LogP of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane is 5.75910. |
| Q: What is the SMILES notation of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane? |
| A: SMILES notation of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane is O=S(=O)(C(=P(O)(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1. |
| Q: What is the molecular formula of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane? |
| A: Molecular formula of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane is C25H21O5PS2. |
| Q: What is the Chinese name of 61368-85-2? |
| A: Chinese name of 61368-85-2 is 61368-85-2. |
| Q: What is the CAS number of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane? |
| A: CAS number of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane is 61368-85-2. |
| Q: What is the InChIKey of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane? |
| A: InChIKey of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane is ZYVDIFBEGDJFER-UHFFFAOYSA-N. |
| Q: What is the molecular weight of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane? |
| A: Molecular weight of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane is 496.53500. |
| Q: What is the polar surface area (PSA) of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane? |
| A: Polar surface area (PSA) of bis(benzenesulfonyl)methylidene-hydroxy-diphenyl-λ5-phosphane is 115.08000. |