tert-butyl 8-methylsulfanyl-9-oxodecanoate
tert-butyl 8-methylsulfanyl-9-oxodecanoate structure
|
Common Name | tert-butyl 8-methylsulfanyl-9-oxodecanoate | ||
|---|---|---|---|---|
| CAS Number | 61369-16-2 | Molecular Weight | 288.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 8-methylsulfanyl-9-oxodecanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H28O3S |
|---|---|
| Molecular Weight | 288.44600 |
| Exact Mass | 288.17600 |
| PSA | 68.67000 |
| LogP | 3.98930 |
| InChIKey | FGXCPWXSZKHXQQ-UHFFFAOYSA-N |
| SMILES | CSC(CCCCCCC(=O)OC(C)(C)C)C(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tert-butyl 8-me... CAS#:61369-16-2 |
| Literature: Kieczykowski,G.R. et al. Journal of Organic Chemistry, 1977 , vol. 42, p. 175 - 176 |
|
~%
tert-butyl 8-me... CAS#:61369-16-2 |
| Literature: Kieczykowski,G.R. et al. Journal of Organic Chemistry, 1977 , vol. 42, p. 175 - 176 |
|
~%
tert-butyl 8-me... CAS#:61369-16-2 |
| Literature: Kieczykowski,G.R. et al. Journal of Organic Chemistry, 1977 , vol. 42, p. 175 - 176 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of tert-butyl 8-methylsulfanyl-9-oxodecanoate? |
| A: Molecular formula of tert-butyl 8-methylsulfanyl-9-oxodecanoate is C15H28O3S. |
| Q: What is the InChIKey of tert-butyl 8-methylsulfanyl-9-oxodecanoate? |
| A: InChIKey of tert-butyl 8-methylsulfanyl-9-oxodecanoate is FGXCPWXSZKHXQQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of tert-butyl 8-methylsulfanyl-9-oxodecanoate? |
| A: Molecular weight of tert-butyl 8-methylsulfanyl-9-oxodecanoate is 288.44600. |
| Q: What is the CAS number of tert-butyl 8-methylsulfanyl-9-oxodecanoate? |
| A: CAS number of tert-butyl 8-methylsulfanyl-9-oxodecanoate is 61369-16-2. |
| Q: What is the Chinese name of 61369-16-2? |
| A: Chinese name of 61369-16-2 is 61369-16-2. |
| Q: What is the LogP of tert-butyl 8-methylsulfanyl-9-oxodecanoate? |
| A: LogP of tert-butyl 8-methylsulfanyl-9-oxodecanoate is 3.98930. |
| Q: What is the English name of tert-butyl 8-methylsulfanyl-9-oxodecanoate? |
| A: The English name of tert-butyl 8-methylsulfanyl-9-oxodecanoate is tert-butyl 8-methylsulfanyl-9-oxodecanoate. |
| Q: What is the polar surface area (PSA) of tert-butyl 8-methylsulfanyl-9-oxodecanoate? |
| A: Polar surface area (PSA) of tert-butyl 8-methylsulfanyl-9-oxodecanoate is 68.67000. |
| Q: What is the SMILES notation of tert-butyl 8-methylsulfanyl-9-oxodecanoate? |
| A: SMILES notation of tert-butyl 8-methylsulfanyl-9-oxodecanoate is CSC(CCCCCCC(=O)OC(C)(C)C)C(C)=O. |