3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one
3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one structure
|
Common Name | 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 61369-32-2 | Molecular Weight | 279.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17NO2 |
|---|---|
| Molecular Weight | 279.33300 |
| Exact Mass | 279.12600 |
| PSA | 29.54000 |
| LogP | 3.58590 |
| InChIKey | MXOSZPHEHOXJNK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(Cc2ccccc2)C(c2ccccc2)O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-benzyl-6-methyl-2-phenyl-2,3-dihydro-4H-1,3-oxazin-4-one |
| 3-benzyl-6-methyl-2-phenyl-1,3-oxazin-4-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one? |
| A: SMILES notation of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one is CC1=CC(=O)N(Cc2ccccc2)C(c2ccccc2)O1. |
| Q: What is the English name of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one? |
| A: The English name of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one is 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one. |
| Q: What is the LogP of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one? |
| A: LogP of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one is 3.58590. |
| Q: What is the InChIKey of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one? |
| A: InChIKey of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one is MXOSZPHEHOXJNK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one? |
| A: CAS number of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one is 61369-32-2. |
| Q: What is the polar surface area (PSA) of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one? |
| A: Polar surface area (PSA) of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one is 29.54000. |
| Q: What English synonyms does 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one have? |
| A: English synonyms of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one: 3-benzyl-6-methyl-2-phenyl-2,3-dihydro-4H-1,3-oxazin-4-one, 3-benzyl-6-methyl-2-phenyl-1,3-oxazin-4-one. |
| Q: What is the molecular formula of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one? |
| A: Molecular formula of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one is C18H17NO2. |
| Q: What is the molecular weight of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one? |
| A: Molecular weight of 3-benzyl-6-methyl-2-phenyl-2H-1,3-oxazin-4-one is 279.33300. |
| Q: What is the Chinese name of 61369-32-2? |
| A: Chinese name of 61369-32-2 is 61369-32-2. |