3-methyl-2-phenyl-1,3-benzoxazol-3-ium,iodide structure
|
Common Name | 3-methyl-2-phenyl-1,3-benzoxazol-3-ium,iodide | ||
|---|---|---|---|---|
| CAS Number | 61372-51-8 | Molecular Weight | 337.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-2-phenyl-1,3-benzoxazol-3-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12INO |
|---|---|
| Molecular Weight | 337.15600 |
| Exact Mass | 336.99600 |
| PSA | 18.07000 |
| LogP | 0.72340 |
| InChIKey | PVQGMTBHIRWTQH-UHFFFAOYSA-M |
| SMILES | C[n+]1c(-c2ccccc2)oc2ccccc21.[I-] |
|
~%
3-methyl-2-phen... CAS#:61372-51-8 |
| Literature: Clark Journal of the Chemical Society, 1926 , p. 233 |
| Benzoxazolium,3-methyl-2-phenyl-,iodide |
| 3-methyl-2-phenyl-benzooxazolium,iodide |
| 3-Methyl-2-phenyl-benzoxazolium,Jodid |
| 1-methyl-2-phenylbenzoxazolium iodide |
| 3-methyl-2-phenyl-benzoxazolium,iodide |