8-Azabicyclo[3.2.1]octane, 8-methyl-, compd. with 2,4,6-trinitrophenol (1:1) structure
|
Common Name | 8-Azabicyclo[3.2.1]octane, 8-methyl-, compd. with 2,4,6-trinitrophenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6138-69-8 | Molecular Weight | 354.31500 | |
| Density | N/A | Boiling Point | 303.6ºC at 760 mmHg | |
| Molecular Formula | C14H18N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.9ºC | |
| Name | 8-methyl-8-azabicyclo[3.2.1]octane,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 303.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H18N4O7 |
| Molecular Weight | 354.31500 |
| Flash Point | 133.9ºC |
| Exact Mass | 354.11800 |
| PSA | 160.93000 |
| LogP | 4.25740 |
| InChIKey | BEYOPVGWSMNKDZ-UHFFFAOYSA-N |
| SMILES | CN1C2CCCC1CC2.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| Tropane,picrate |
| 2,4,6-trinitrophenol-8-methyl-8-azabicyclo[3.2.1]octane(1:1) |