Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate
Modify Date: 2026-10-05 18:21:23
Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate structure
|
Common Name | Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 61381-06-4 | Molecular Weight | 266.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11ClO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11ClO7 |
|---|---|
| Molecular Weight | 266.63 |
| InChIKey | YXDZGIMEFIMYMZ-RNFRBKRXSA-N |
| SMILES | COC(=O)C(OC(C)=O)C(OC(C)=O)C(=O)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate? |
| A: The English name of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate is Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate. |
| Q: What is the molecular weight of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate? |
| A: Molecular weight of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate is 266.63. |
| Q: What is the SMILES notation of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate? |
| A: SMILES notation of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate is COC(=O)C(OC(C)=O)C(OC(C)=O)C(=O)Cl. |
| Q: What is the molecular formula of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate? |
| A: Molecular formula of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate is C9H11ClO7. |
| Q: What is the CAS number of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate? |
| A: CAS number of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate is 61381-06-4. |
| Q: What is the InChIKey of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate? |
| A: InChIKey of Methyl (2R,3R)-2,3-bis(acetyloxy)-4-chloro-4-oxobutanoate is YXDZGIMEFIMYMZ-RNFRBKRXSA-N. |
| Q: What is the Chinese name of 61381-06-4? |
| A: Chinese name of 61381-06-4 is 61381-06-4. |